C31H22F6N4O2 — CID 118677327
3-fluoro-N-methyl-5-(2-methylphenyl)-N-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]benzamide (PubChem CID 118677327) has the molecular formula C31H22F6N4O2 and a molecular weight of 596.53 g/mol. Its IUPAC name is 3-fluoro-N-methyl-5-(2-methylphenyl)-N-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]benzamide.
| Compound Name | 3-fluoro-N-methyl-5-(2-methylphenyl)-N-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 118677327 |
| Molecular Formula | C31H22F6N4O2 |
| Molecular Weight | 596.53 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 3-fluoro-N-methyl-5-(2-methylphenyl)-N-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]benzamide |
| SMILES | Cc1ccccc1-c1cc(F)cc(C(=O)N(C)c2ccc(-c3ncn(-c4ccc(OC(F)(F)C(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C31H22F6N4O2/c1-19-5-3-4-6-27(19)21-15-22(17-23(32)16-21)29(42)40(2)24-9-7-20(8-10-24)28-38-18-41(39-28)25-11-13-26(14-12-25)43-31(36,37)30(33,34)35/h3-18H,1-2H3 |
| InChIKey | ZXNFELKCWAJVBW-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.53 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|