C16H11F5N4O — CID 141246556
2-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]aniline (PubChem CID 141246556) has the molecular formula C16H11F5N4O and a molecular weight of 370.28 g/mol. Its IUPAC name is 2-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 141246556 |
| Molecular Formula | C16H11F5N4O |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1ccccc1-c1ncn(-c2ccc(OC(F)(F)C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C16H11F5N4O/c17-15(18,19)16(20,21)26-11-7-5-10(6-8-11)25-9-23-14(24-25)12-3-1-2-4-13(12)22/h1-9H,22H2 |
| InChIKey | LQSYSTGDWUHRRJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|