C17H17F6N5O — CID 162583987
(3S)-5-[2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine (PubChem CID 162583987) has the molecular formula C17H17F6N5O and a molecular weight of 421.35 g/mol. Its IUPAC name is (3S)-5-[2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine.
| Compound Name | (3S)-5-[2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 162583987 |
| Molecular Formula | C17H17F6N5O |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (3S)-5-[2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine |
| SMILES | N[C@H]1CC(N2CCn3nc(C(F)(F)F)nc3C2)COC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H17F6N5O/c18-10-5-12(20)11(19)4-9(10)15-13(24)3-8(7-29-15)27-1-2-28-14(6-27)25-16(26-28)17(21,22)23/h4-5,8,13,15H,1-3,6-7,24H2/t8?,13-,15?/m0/s1 |
| InChIKey | XNDUWPJESLWYQW-KYAFNEOASA-N |
| XLogP | 2.39 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|