C19H18F6N4O — CID 24781048
(2R,3S,5R)-5-[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine (PubChem CID 24781048) has the molecular formula C19H18F6N4O and a molecular weight of 432.37 g/mol. Its IUPAC name is (2R,3S,5R)-5-[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-5-[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 24781048 |
| Molecular Formula | C19H18F6N4O |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (2R,3S,5R)-5-[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine |
| SMILES | N[C@H]1C[C@@H](N2CCc3nc(C(F)(F)F)ncc3C2)CO[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H18F6N4O/c20-12-5-14(22)13(21)4-11(12)17-15(26)3-10(8-30-17)29-2-1-16-9(7-29)6-27-18(28-16)19(23,24)25/h4-6,10,15,17H,1-3,7-8,26H2/t10-,15+,17-/m1/s1 |
| InChIKey | LZKJDSVZROOFQA-TYFHEEPYSA-N |
| XLogP | 3.13 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|