C29H23F5N2O8 — CID 162585092
[4-[(E)-3-[2-(2-nitro-4-nitrosophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate (PubChem CID 162585092) has the molecular formula C29H23F5N2O8 and a molecular weight of 622.50 g/mol. Its IUPAC name is [4-[(E)-3-[2-(2-nitro-4-nitrosophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate.
| Compound Name | [4-[(E)-3-[2-(2-nitro-4-nitrosophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate |
|---|---|
| PubChem CID | 162585092 |
| Molecular Formula | C29H23F5N2O8 |
| Molecular Weight | 622.50 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | [4-[(E)-3-[2-(2-nitro-4-nitrosophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate |
| SMILES | O=Nc1ccc(CCOC(=O)/C=C/c2ccc(OC(=O)c3ccc(OCCCC(F)(F)C(F)(F)F)cc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H23F5N2O8/c30-28(31,29(32,33)34)15-1-16-42-23-11-6-21(7-12-23)27(38)44-24-9-2-19(3-10-24)4-13-26(37)43-17-14-20-5-8-22(35-39)18-25(20)36(40)41/h2-13,18H,1,14-17H2/b13-4+ |
| InChIKey | VQWAJXZQGCAECS-YIXHJXPBSA-N |
| XLogP | 7.37 |
| TPSA | 134.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.50 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|