C22H22Cl2F3IN2 — CID 162592967
N-[[2-chloro-4-[(E)-3-[3-chloro-4-[(E)-2-iodoethenyl]phenyl]-4,4,4-trifluorobut-1-enyl]phenyl]methyl]-N',N'-dimethylmethanediamine (PubChem CID 162592967) has the molecular formula C22H22Cl2F3IN2 and a molecular weight of 569.24 g/mol. Its IUPAC name is N-[[2-chloro-4-[(E)-3-[3-chloro-4-[(E)-2-iodoethenyl]phenyl]-4,4,4-trifluorobut-1-enyl]phenyl]methyl]-N',N'-dimethylmethanediamine.
| Compound Name | N-[[2-chloro-4-[(E)-3-[3-chloro-4-[(E)-2-iodoethenyl]phenyl]-4,4,4-trifluorobut-1-enyl]phenyl]methyl]-N',N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 162592967 |
| Molecular Formula | C22H22Cl2F3IN2 |
| Molecular Weight | 569.24 g/mol |
| Exact Mass | 568.02 |
| IUPAC Name | N-[[2-chloro-4-[(E)-3-[3-chloro-4-[(E)-2-iodoethenyl]phenyl]-4,4,4-trifluorobut-1-enyl]phenyl]methyl]-N',N'-dimethylmethanediamine |
| SMILES | CN(C)CNCc1ccc(/C=C/C(c2ccc(/C=C/I)c(Cl)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C22H22Cl2F3IN2/c1-30(2)14-29-13-18-5-3-15(11-20(18)23)4-8-19(22(25,26)27)17-7-6-16(9-10-28)21(24)12-17/h3-12,19,29H,13-14H2,1-2H3/b8-4+,10-9+ |
| InChIKey | ISSISMQURLHSGS-OOOLMBCVSA-N |
| XLogP | 7.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.24 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|