C21H16F11N3O3 — CID 162600351
N-[4-(1,1-difluoroethoxy)phenyl]-2-[4-(4,4,4-trifluorobut-1-en-2-yl)-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-N-(trifluoromethyl)acetamide (PubChem CID 162600351) has the molecular formula C21H16F11N3O3 and a molecular weight of 567.36 g/mol. Its IUPAC name is N-[4-(1,1-difluoroethoxy)phenyl]-2-[4-(4,4,4-trifluorobut-1-en-2-yl)-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-N-(trifluoromethyl)acetamide.
| Compound Name | N-[4-(1,1-difluoroethoxy)phenyl]-2-[4-(4,4,4-trifluorobut-1-en-2-yl)-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-N-(trifluoromethyl)acetamide |
|---|---|
| PubChem CID | 162600351 |
| Molecular Formula | C21H16F11N3O3 |
| Molecular Weight | 567.36 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | N-[4-(1,1-difluoroethoxy)phenyl]-2-[4-(4,4,4-trifluorobut-1-en-2-yl)-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-N-(trifluoromethyl)acetamide |
| SMILES | C=C(CC(F)(F)F)c1cc(OCC(F)(F)F)nc(CC(=O)N(c2ccc(OC(C)(F)F)cc2)C(F)(F)F)n1 |
| InChI | InChI=1S/C21H16F11N3O3/c1-11(9-19(24,25)26)14-7-16(37-10-20(27,28)29)34-15(33-14)8-17(36)35(21(30,31)32)12-3-5-13(6-4-12)38-18(2,22)23/h3-7H,1,8-10H2,2H3 |
| InChIKey | KWJNMXSRCJAYLV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.36 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|