C20H28ClN3O4 — CID 162625101
4-N-(5-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;oxalic acid (PubChem CID 162625101) has the molecular formula C20H28ClN3O4 and a molecular weight of 409.91 g/mol. Its IUPAC name is 4-N-(5-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;oxalic acid.
| Compound Name | 4-N-(5-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;oxalic acid |
|---|---|
| PubChem CID | 162625101 |
| Molecular Formula | C20H28ClN3O4 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-N-(5-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;oxalic acid |
| SMILES | CCN(CC)CCCC(C)Nc1ccnc2cccc(Cl)c12.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H26ClN3.C2H2O4/c1-4-22(5-2)13-7-8-14(3)21-17-11-12-20-16-10-6-9-15(19)18(16)17;3-1(4)2(5)6/h6,9-12,14H,4-5,7-8,13H2,1-3H3,(H,20,21);(H,3,4)(H,5,6) |
| InChIKey | DZLATVULAQHXCG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|