C38H34ClN7O7 — CID 162664856
5-(3-chloroanilino)-N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 162664856) has the molecular formula C38H34ClN7O7 and a molecular weight of 736.19 g/mol. Its IUPAC name is 5-(3-chloroanilino)-N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-(3-chloroanilino)-N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 162664856 |
| Molecular Formula | C38H34ClN7O7 |
| Molecular Weight | 736.19 g/mol |
| Exact Mass | 735.22 |
| IUPAC Name | 5-(3-chloroanilino)-N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCOCCOCCNC(=O)c4ccc5c(c4)nc(Nc4cccc(Cl)c4)c4ccncc45)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C38H34ClN7O7/c39-23-3-1-4-24(20-23)43-34-26-11-12-40-21-28(26)25-8-7-22(19-30(25)44-34)35(48)42-14-16-53-18-17-52-15-13-41-29-6-2-5-27-33(29)38(51)46(37(27)50)31-9-10-32(47)45-36(31)49/h1-8,11-12,19-21,31,41H,9-10,13-18H2,(H,42,48)(H,43,44)(H,45,47,49) |
| InChIKey | XINDYXJSNZXEEK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 180.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.19 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|