C16H15F3N2O — CID 162687909
(1R,2R)-6-amino-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 162687909) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is (1R,2R)-6-amino-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2R)-6-amino-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 162687909 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (1R,2R)-6-amino-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | Nc1ccc2c(c1)[C@@H](Nc1cccc(C(F)(F)F)c1)[C@H](O)C2 |
| InChI | InChI=1S/C16H15F3N2O/c17-16(18,19)10-2-1-3-12(7-10)21-15-13-8-11(20)5-4-9(13)6-14(15)22/h1-5,7-8,14-15,21-22H,6,20H2/t14-,15-/m1/s1 |
| InChIKey | HNJAJMHFUZAUAY-HUUCEWRRSA-N |
| XLogP | 3.36 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|