C33H36N4O4 — CID 162697018
3'-methylidene-1-[9-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-pyrrolidine]-1-yl)nonyl]spiro[indole-3,5'-pyrrolidine]-2,2'-dione (PubChem CID 162697018) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3'-methylidene-1-[9-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-pyrrolidine]-1-yl)nonyl]spiro[indole-3,5'-pyrrolidine]-2,2'-dione.
| Compound Name | 3'-methylidene-1-[9-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-pyrrolidine]-1-yl)nonyl]spiro[indole-3,5'-pyrrolidine]-2,2'-dione |
|---|---|
| PubChem CID | 162697018 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 3'-methylidene-1-[9-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-pyrrolidine]-1-yl)nonyl]spiro[indole-3,5'-pyrrolidine]-2,2'-dione |
| SMILES | C=C1CC2(NC1=O)C(=O)N(CCCCCCCCCN1C(=O)C3(CC(=C)C(=O)N3)c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C33H36N4O4/c1-22-20-32(34-28(22)38)24-14-8-10-16-26(24)36(30(32)40)18-12-6-4-3-5-7-13-19-37-27-17-11-9-15-25(27)33(31(37)41)21-23(2)29(39)35-33/h8-11,14-17H,1-7,12-13,18-21H2,(H,34,38)(H,35,39) |
| InChIKey | UTAHODCNNILTTE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|