C27H30O6 — CID 162697480
4-O-(3,5-dimethyl-4-phenylphenyl) 1-O-(2-prop-2-enoyloxyethyl) cyclohexane-1,4-dicarboxylate (PubChem CID 162697480) has the molecular formula C27H30O6 and a molecular weight of 450.53 g/mol. Its IUPAC name is 4-O-(3,5-dimethyl-4-phenylphenyl) 1-O-(2-prop-2-enoyloxyethyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-(3,5-dimethyl-4-phenylphenyl) 1-O-(2-prop-2-enoyloxyethyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 162697480 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 4-O-(3,5-dimethyl-4-phenylphenyl) 1-O-(2-prop-2-enoyloxyethyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCOC(=O)C1CCC(C(=O)Oc2cc(C)c(-c3ccccc3)c(C)c2)CC1 |
| InChI | InChI=1S/C27H30O6/c1-4-24(28)31-14-15-32-26(29)21-10-12-22(13-11-21)27(30)33-23-16-18(2)25(19(3)17-23)20-8-6-5-7-9-20/h4-9,16-17,21-22H,1,10-15H2,2-3H3 |
| InChIKey | GDZMFAQINLJFRK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|