C8H16F2N2 — CID 162721844
(Z,4E)-4-(difluoromethylimino)pent-2-en-2-amine;ethane (PubChem CID 162721844) has the molecular formula C8H16F2N2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (Z,4E)-4-(difluoromethylimino)pent-2-en-2-amine;ethane.
| Compound Name | (Z,4E)-4-(difluoromethylimino)pent-2-en-2-amine;ethane |
|---|---|
| PubChem CID | 162721844 |
| Molecular Formula | C8H16F2N2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | (Z,4E)-4-(difluoromethylimino)pent-2-en-2-amine;ethane |
| SMILES | C/C(N)=C/C(C)=N/C(F)F.CC |
| InChI | InChI=1S/C6H10F2N2.C2H6/c1-4(9)3-5(2)10-6(7)8;1-2/h3,6H,9H2,1-2H3;1-2H3/b4-3-,10-5+; |
| InChIKey | LPOOIRZQASORCO-HGMYAUDCSA-N |
| XLogP | 2.56 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|