C8H15ClN2 — CID 162729843
(1E,2Z)-2-ethylidene-N-methylpentanehydrazonoyl chloride (PubChem CID 162729843) has the molecular formula C8H15ClN2 and a molecular weight of 174.67 g/mol. Its IUPAC name is (1E,2Z)-2-ethylidene-N-methylpentanehydrazonoyl chloride.
| Compound Name | (1E,2Z)-2-ethylidene-N-methylpentanehydrazonoyl chloride |
|---|---|
| PubChem CID | 162729843 |
| Molecular Formula | C8H15ClN2 |
| Molecular Weight | 174.67 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (1E,2Z)-2-ethylidene-N-methylpentanehydrazonoyl chloride |
| SMILES | C/C=C(CCC)\C(Cl)=N/NC |
| InChI | InChI=1S/C8H15ClN2/c1-4-6-7(5-2)8(9)11-10-3/h5,10H,4,6H2,1-3H3/b7-5-,11-8+ |
| InChIKey | GPDOEKJZRDRIPG-UKJSTWFMSA-N |
| XLogP | 2.50 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|