C10H7FN2 — CID 162737981
8-fluoro-3,4-dihydroisoquinoline-6-carbonitrile (PubChem CID 162737981) has the molecular formula C10H7FN2 and a molecular weight of 174.18 g/mol. Its IUPAC name is 8-fluoro-3,4-dihydroisoquinoline-6-carbonitrile.
| Compound Name | 8-fluoro-3,4-dihydroisoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 162737981 |
| Molecular Formula | C10H7FN2 |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 8-fluoro-3,4-dihydroisoquinoline-6-carbonitrile |
| SMILES | N#Cc1cc(F)c2c(c1)CCN=C2 |
| InChI | InChI=1S/C10H7FN2/c11-10-4-7(5-12)3-8-1-2-13-6-9(8)10/h3-4,6H,1-2H2 |
| InChIKey | NZACPOPRHNOPEY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |