C36H41N7O7 — CID 162749916
4-[4-[2-[(5-cyclobutyl-1H-pyrazol-3-yl)amino]-2-oxoethyl]phenoxy]-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]butanamide (PubChem CID 162749916) has the molecular formula C36H41N7O7 and a molecular weight of 683.77 g/mol. Its IUPAC name is 4-[4-[2-[(5-cyclobutyl-1H-pyrazol-3-yl)amino]-2-oxoethyl]phenoxy]-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]butanamide.
| Compound Name | 4-[4-[2-[(5-cyclobutyl-1H-pyrazol-3-yl)amino]-2-oxoethyl]phenoxy]-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]butanamide |
|---|---|
| PubChem CID | 162749916 |
| Molecular Formula | C36H41N7O7 |
| Molecular Weight | 683.77 g/mol |
| Exact Mass | 683.31 |
| IUPAC Name | 4-[4-[2-[(5-cyclobutyl-1H-pyrazol-3-yl)amino]-2-oxoethyl]phenoxy]-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]butanamide |
| SMILES | O=C(CCCOc1ccc(CC(=O)Nc2cc(C3CCC3)[nH]n2)cc1)NCCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C36H41N7O7/c44-30(10-5-19-50-24-13-11-22(12-14-24)20-32(46)39-29-21-27(41-42-29)23-6-3-7-23)38-18-2-1-17-37-26-9-4-8-25-33(26)36(49)43(35(25)48)28-15-16-31(45)40-34(28)47/h4,8-9,11-14,21,23,28,37H,1-3,5-7,10,15-20H2,(H,38,44)(H,40,45,47)(H2,39,41,42,46) |
| InChIKey | BEYPVZLSMWIZRD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 191.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.77 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|