C21H23Cl2N4O4+ — CID 162749956
3-[[(2R,3S)-1-[7,8-dichloro-4-(1H-imidazol-3-ium-3-yl)quinolin-2-yl]-3-methoxypyrrolidin-2-yl]methoxy]propanoic acid (PubChem CID 162749956) has the molecular formula C21H23Cl2N4O4+ and a molecular weight of 466.35 g/mol. Its IUPAC name is 3-[[(2R,3S)-1-[7,8-dichloro-4-(1H-imidazol-3-ium-3-yl)quinolin-2-yl]-3-methoxypyrrolidin-2-yl]methoxy]propanoic acid.
| Compound Name | 3-[[(2R,3S)-1-[7,8-dichloro-4-(1H-imidazol-3-ium-3-yl)quinolin-2-yl]-3-methoxypyrrolidin-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 162749956 |
| Molecular Formula | C21H23Cl2N4O4+ |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 3-[[(2R,3S)-1-[7,8-dichloro-4-(1H-imidazol-3-ium-3-yl)quinolin-2-yl]-3-methoxypyrrolidin-2-yl]methoxy]propanoic acid |
| SMILES | CO[C@H]1CCN(c2cc(-[n+]3cc[nH]c3)c3ccc(Cl)c(Cl)c3n2)[C@@H]1COCCC(=O)O |
| InChI | InChI=1S/C21H22Cl2N4O4/c1-30-17-4-7-27(16(17)11-31-9-5-19(28)29)18-10-15(26-8-6-24-12-26)13-2-3-14(22)20(23)21(13)25-18/h2-3,6,8,10,12,16-17H,4-5,7,9,11H2,1H3,(H,28,29)/p+1/t16-,17+/m1/s1 |
| InChIKey | FNWTYOBEBNPQGG-SJORKVTESA-O |
| XLogP | 3.23 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|