C34H42N4O2 — CID 162756425
ethene;1-[3-(4-methylnaphthalen-1-yl)phenyl]propan-1-amine;4-[(4-methyl-2-pyridinyl)amino]-N-(2-oxoethyl)butanamide (PubChem CID 162756425) has the molecular formula C34H42N4O2 and a molecular weight of 538.74 g/mol. Its IUPAC name is ethene;1-[3-(4-methylnaphthalen-1-yl)phenyl]propan-1-amine;4-[(4-methyl-2-pyridinyl)amino]-N-(2-oxoethyl)butanamide.
| Compound Name | ethene;1-[3-(4-methylnaphthalen-1-yl)phenyl]propan-1-amine;4-[(4-methyl-2-pyridinyl)amino]-N-(2-oxoethyl)butanamide |
|---|---|
| PubChem CID | 162756425 |
| Molecular Formula | C34H42N4O2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | ethene;1-[3-(4-methylnaphthalen-1-yl)phenyl]propan-1-amine;4-[(4-methyl-2-pyridinyl)amino]-N-(2-oxoethyl)butanamide |
| SMILES | C=C.CCC(N)c1cccc(-c2ccc(C)c3ccccc23)c1.Cc1ccnc(NCCCC(=O)NCC=O)c1 |
| InChI | InChI=1S/C20H21N.C12H17N3O2.C2H4/c1-3-20(21)16-8-6-7-15(13-16)18-12-11-14(2)17-9-4-5-10-19(17)18;1-10-4-6-14-11(9-10)13-5-2-3-12(17)15-7-8-16;1-2/h4-13,20H,3,21H2,1-2H3;4,6,8-9H,2-3,5,7H2,1H3,(H,13,14)(H,15,17);1-2H2 |
| InChIKey | QLHHKYOJBBDIPM-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|