C26H33FN4OS — CID 162759734
N,N-diethyl-2-fluoro-4-[7-(3-piperidin-1-ylpropylamino)thieno[3,2-b]pyridin-5-yl]benzamide (PubChem CID 162759734) has the molecular formula C26H33FN4OS and a molecular weight of 468.64 g/mol. Its IUPAC name is N,N-diethyl-2-fluoro-4-[7-(3-piperidin-1-ylpropylamino)thieno[3,2-b]pyridin-5-yl]benzamide.
| Compound Name | N,N-diethyl-2-fluoro-4-[7-(3-piperidin-1-ylpropylamino)thieno[3,2-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 162759734 |
| Molecular Formula | C26H33FN4OS |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N,N-diethyl-2-fluoro-4-[7-(3-piperidin-1-ylpropylamino)thieno[3,2-b]pyridin-5-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(-c2cc(NCCCN3CCCCC3)c3sccc3n2)cc1F |
| InChI | InChI=1S/C26H33FN4OS/c1-3-31(4-2)26(32)20-10-9-19(17-21(20)27)23-18-24(25-22(29-23)11-16-33-25)28-12-8-15-30-13-6-5-7-14-30/h9-11,16-18H,3-8,12-15H2,1-2H3,(H,28,29) |
| InChIKey | WNQBBINMHHNDJO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|