C15H12ClIN4O — CID 162761816
2-chloro-7-iodo-6-methoxy-N-(pyridin-4-ylmethyl)quinazolin-4-amine (PubChem CID 162761816) has the molecular formula C15H12ClIN4O and a molecular weight of 426.65 g/mol. Its IUPAC name is 2-chloro-7-iodo-6-methoxy-N-(pyridin-4-ylmethyl)quinazolin-4-amine.
| Compound Name | 2-chloro-7-iodo-6-methoxy-N-(pyridin-4-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 162761816 |
| Molecular Formula | C15H12ClIN4O |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | 2-chloro-7-iodo-6-methoxy-N-(pyridin-4-ylmethyl)quinazolin-4-amine |
| SMILES | COc1cc2c(NCc3ccncc3)nc(Cl)nc2cc1I |
| InChI | InChI=1S/C15H12ClIN4O/c1-22-13-6-10-12(7-11(13)17)20-15(16)21-14(10)19-8-9-2-4-18-5-3-9/h2-7H,8H2,1H3,(H,19,20,21) |
| InChIKey | BIZJMBIAAXVCLR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|