About 2-bromo-3-methylbutanal;ethane
2-bromo-3-methylbutanal;ethane (PubChem CID 162765378) has the molecular formula C7H15BrO
and a molecular weight of 195.10 g/mol. Its IUPAC name is 2-bromo-3-methylbutanal;ethane.
Molecular Properties
| Compound Name | 2-bromo-3-methylbutanal;ethane |
| PubChem CID | 162765378 |
| Molecular Formula | C7H15BrO |
| Molecular Weight | 195.10 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2-bromo-3-methylbutanal;ethane |
| SMILES | CC.CC(C)C(Br)C=O |
| InChI | InChI=1S/C5H9BrO.C2H6/c1-4(2)5(6)3-7;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | YPYRSFKGQVPBOG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.10 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-methylbutanal;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-methylbutanal;ethane?
The IUPAC name of 2-bromo-3-methylbutanal;ethane (CID 162765378) is 2-bromo-3-methylbutanal;ethane.
What is the SMILES notation for 2-bromo-3-methylbutanal;ethane?
The canonical SMILES for 2-bromo-3-methylbutanal;ethane is CC.CC(C)C(Br)C=O.
What is the InChIKey of 2-bromo-3-methylbutanal;ethane?
The InChIKey is YPYRSFKGQVPBOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9BrO.C2H6/c1-4(2)5(6)3-7;1-2/h3-5H,1-2H3;1-2H3.
What are the key properties of 2-bromo-3-methylbutanal;ethane?
2-bromo-3-methylbutanal;ethane has a molecular weight of 195.10 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-methylbutanal;ethane is sourced from PubChem (CID 162765378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).