C24H36NO7+ — CID 162773274
diethyl-[2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-2-oxoethyl]-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 162773274) has the molecular formula C24H36NO7+ and a molecular weight of 450.55 g/mol. Its IUPAC name is diethyl-[2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-2-oxoethyl]-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | diethyl-[2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-2-oxoethyl]-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 162773274 |
| Molecular Formula | C24H36NO7+ |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | diethyl-[2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-2-oxoethyl]-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+](CC)(CC)CC(=O)OCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C24H36NO7/c1-7-25(8-2,13-14-32-23(28)18(3)4)17-21(26)31-16-15-30-20-11-9-19(10-12-20)22(27)24(5,6)29/h9-12,29H,3,7-8,13-17H2,1-2,4-6H3/q+1 |
| InChIKey | FMJVRGYASFTFNV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|