C21H30N2O12 — CID 162774600
4-[2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-3-methoxypropoxy]carbonyloxybutyl acetate (PubChem CID 162774600) has the molecular formula C21H30N2O12 and a molecular weight of 502.47 g/mol. Its IUPAC name is 4-[2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-3-methoxypropoxy]carbonyloxybutyl acetate.
| Compound Name | 4-[2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-3-methoxypropoxy]carbonyloxybutyl acetate |
|---|---|
| PubChem CID | 162774600 |
| Molecular Formula | C21H30N2O12 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 4-[2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-3-methoxypropoxy]carbonyloxybutyl acetate |
| SMILES | COCC(COC(=O)OCCCCOC(C)=O)NC(=O)OCc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H30N2O12/c1-14(24)32-7-5-6-8-33-21(26)35-13-16(12-29-2)22-20(25)34-11-15-9-18(30-3)19(31-4)10-17(15)23(27)28/h9-10,16H,5-8,11-13H2,1-4H3,(H,22,25) |
| InChIKey | SAYPDJGYOUKOLN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 170.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|