C33H44NO4P — CID 162781281
ethyl-[3-[(2E)-2-[(E)-3-[3-(3-methoxypropyl)-1,1-dimethylinden-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]propoxy]phosphinic acid (PubChem CID 162781281) has the molecular formula C33H44NO4P and a molecular weight of 549.69 g/mol. Its IUPAC name is ethyl-[3-[(2E)-2-[(E)-3-[3-(3-methoxypropyl)-1,1-dimethylinden-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]propoxy]phosphinic acid.
| Compound Name | ethyl-[3-[(2E)-2-[(E)-3-[3-(3-methoxypropyl)-1,1-dimethylinden-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]propoxy]phosphinic acid |
|---|---|
| PubChem CID | 162781281 |
| Molecular Formula | C33H44NO4P |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | ethyl-[3-[(2E)-2-[(E)-3-[3-(3-methoxypropyl)-1,1-dimethylinden-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]propoxy]phosphinic acid |
| SMILES | CCP(=O)(O)OCCCN1/C(=C/C=C/C2=C(CCCOC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C33H44NO4P/c1-7-39(35,36)38-24-14-22-34-30-20-11-10-18-29(30)33(4,5)31(34)21-12-19-28-26(16-13-23-37-6)25-15-8-9-17-27(25)32(28,2)3/h8-12,15,17-21H,7,13-14,16,22-24H2,1-6H3,(H,35,36)/b19-12+,31-21+ |
| InChIKey | CMAOIGGKPCWJGD-TUYBDHHKSA-N |
| XLogP | 8.01 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|