C21H28O5 — CID 162803519
(3S)-6-(3,7-dimethylocta-2,6-dienoxy)-8-hydroxy-5-methoxy-3-methyl-3,4-dihydroisochromen-1-one (PubChem CID 162803519) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (3S)-6-(3,7-dimethylocta-2,6-dienoxy)-8-hydroxy-5-methoxy-3-methyl-3,4-dihydroisochromen-1-one.
| Compound Name | (3S)-6-(3,7-dimethylocta-2,6-dienoxy)-8-hydroxy-5-methoxy-3-methyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 162803519 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (3S)-6-(3,7-dimethylocta-2,6-dienoxy)-8-hydroxy-5-methoxy-3-methyl-3,4-dihydroisochromen-1-one |
| SMILES | COc1c(OCC=C(C)CCC=C(C)C)cc(O)c2c1C[C@H](C)OC2=O |
| InChI | InChI=1S/C21H28O5/c1-13(2)7-6-8-14(3)9-10-25-18-12-17(22)19-16(20(18)24-5)11-15(4)26-21(19)23/h7,9,12,15,22H,6,8,10-11H2,1-5H3/t15-/m0/s1 |
| InChIKey | MOMMXCDOMXCEJA-HNNXBMFYSA-N |
| XLogP | 4.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|