C32H45NO4 — CID 162842564
9-[3-(3-hydroxy-4,6-dimethyl-8-phenyloct-4-en-2-yl)-2-methyloxiran-2-yl]-N-(1-hydroxypropan-2-yl)-2-methylnona-2,4,6,8-tetraenamide (PubChem CID 162842564) has the molecular formula C32H45NO4 and a molecular weight of 507.72 g/mol. Its IUPAC name is 9-[3-(3-hydroxy-4,6-dimethyl-8-phenyloct-4-en-2-yl)-2-methyloxiran-2-yl]-N-(1-hydroxypropan-2-yl)-2-methylnona-2,4,6,8-tetraenamide.
| Compound Name | 9-[3-(3-hydroxy-4,6-dimethyl-8-phenyloct-4-en-2-yl)-2-methyloxiran-2-yl]-N-(1-hydroxypropan-2-yl)-2-methylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 162842564 |
| Molecular Formula | C32H45NO4 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | 9-[3-(3-hydroxy-4,6-dimethyl-8-phenyloct-4-en-2-yl)-2-methyloxiran-2-yl]-N-(1-hydroxypropan-2-yl)-2-methylnona-2,4,6,8-tetraenamide |
| SMILES | CC(=CC=CC=CC=CC1(C)OC1C(C)C(O)C(C)=CC(C)CCc1ccccc1)C(=O)NC(C)CO |
| InChI | InChI=1S/C32H45NO4/c1-23(18-19-28-16-12-10-13-17-28)21-25(3)29(35)27(5)30-32(6,37-30)20-14-9-7-8-11-15-24(2)31(36)33-26(4)22-34/h7-17,20-21,23,26-27,29-30,34-35H,18-19,22H2,1-6H3,(H,33,36) |
| InChIKey | NSDCZUSAJCYTGH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|