C21H22O7 — CID 162857768
(2R,3R)-3,5-dihydroxy-2-(2-hydroxy-4-methoxyphenyl)-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one (PubChem CID 162857768) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is (2R,3R)-3,5-dihydroxy-2-(2-hydroxy-4-methoxyphenyl)-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one.
| Compound Name | (2R,3R)-3,5-dihydroxy-2-(2-hydroxy-4-methoxyphenyl)-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 162857768 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2R,3R)-3,5-dihydroxy-2-(2-hydroxy-4-methoxyphenyl)-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one |
| SMILES | COc1ccc([C@H]2Oc3c4c(cc(O)c3C(=O)[C@@H]2O)OC(C)(C)CC4)c(O)c1 |
| InChI | InChI=1S/C21H22O7/c1-21(2)7-6-12-15(28-21)9-14(23)16-17(24)18(25)20(27-19(12)16)11-5-4-10(26-3)8-13(11)22/h4-5,8-9,18,20,22-23,25H,6-7H2,1-3H3/t18-,20+/m0/s1 |
| InChIKey | YOVXQNOKBPXHOT-AZUAARDMSA-N |
| XLogP | 2.89 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |