C26H40ClNO5 — CID 162909176
[(1R)-3-[(E)-1-chloro-3-[[(E,7S)-7-methoxytetradec-4-enoyl]amino]prop-1-en-2-yl]-2-oxocyclohex-3-en-1-yl] acetate (PubChem CID 162909176) has the molecular formula C26H40ClNO5 and a molecular weight of 482.06 g/mol. Its IUPAC name is [(1R)-3-[(E)-1-chloro-3-[[(E,7S)-7-methoxytetradec-4-enoyl]amino]prop-1-en-2-yl]-2-oxocyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R)-3-[(E)-1-chloro-3-[[(E,7S)-7-methoxytetradec-4-enoyl]amino]prop-1-en-2-yl]-2-oxocyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 162909176 |
| Molecular Formula | C26H40ClNO5 |
| Molecular Weight | 482.06 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | [(1R)-3-[(E)-1-chloro-3-[[(E,7S)-7-methoxytetradec-4-enoyl]amino]prop-1-en-2-yl]-2-oxocyclohex-3-en-1-yl] acetate |
| SMILES | CCCCCCC[C@@H](C/C=C/CCC(=O)NC/C(=C/Cl)C1=CCC[C@@H](OC(C)=O)C1=O)OC |
| InChI | InChI=1S/C26H40ClNO5/c1-4-5-6-7-9-13-22(32-3)14-10-8-11-17-25(30)28-19-21(18-27)23-15-12-16-24(26(23)31)33-20(2)29/h8,10,15,18,22,24H,4-7,9,11-14,16-17,19H2,1-3H3,(H,28,30)/b10-8+,21-18-/t22-,24+/m0/s1 |
| InChIKey | GNKNIPRNBZCJGO-KHCJTUSTSA-N |
| XLogP | 5.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.06 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|