C26H42ClNO7 — CID 20847478
acetic acid;(E,7S)-N-[(Z)-3-chloro-2-[(1S,5S,6S)-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]prop-2-enyl]-7-methoxytetradec-4-enamide (PubChem CID 20847478) has the molecular formula C26H42ClNO7 and a molecular weight of 516.08 g/mol. Its IUPAC name is acetic acid;(E,7S)-N-[(Z)-3-chloro-2-[(1S,5S,6S)-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]prop-2-enyl]-7-methoxytetradec-4-enamide.
| Compound Name | acetic acid;(E,7S)-N-[(Z)-3-chloro-2-[(1S,5S,6S)-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]prop-2-enyl]-7-methoxytetradec-4-enamide |
|---|---|
| PubChem CID | 20847478 |
| Molecular Formula | C26H42ClNO7 |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | acetic acid;(E,7S)-N-[(Z)-3-chloro-2-[(1S,5S,6S)-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]prop-2-enyl]-7-methoxytetradec-4-enamide |
| SMILES | CC(=O)O.CCCCCCC[C@@H](C/C=C/CCC(=O)NC/C(=C/Cl)[C@]12O[C@H]1[C@@H](O)CCC2=O)OC |
| InChI | InChI=1S/C24H38ClNO5.C2H4O2/c1-3-4-5-6-8-11-19(30-2)12-9-7-10-13-22(29)26-17-18(16-25)24-21(28)15-14-20(27)23(24)31-24;1-2(3)4/h7,9,16,19-20,23,27H,3-6,8,10-15,17H2,1-2H3,(H,26,29);1H3,(H,3,4)/b9-7+,18-16-;/t19-,20-,23-,24+;/m0./s1 |
| InChIKey | DDQAZBCVDNJVJF-NUWPRWQBSA-N |
| XLogP | 4.28 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|