C25H40ClNO5 — CID 162815356
N-[3-chloro-2-(4-hydroxy-3-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl)prop-2-enyl]-7-methoxytetradec-4-enamide (PubChem CID 162815356) has the molecular formula C25H40ClNO5 and a molecular weight of 470.05 g/mol. Its IUPAC name is N-[3-chloro-2-(4-hydroxy-3-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl)prop-2-enyl]-7-methoxytetradec-4-enamide.
| Compound Name | N-[3-chloro-2-(4-hydroxy-3-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl)prop-2-enyl]-7-methoxytetradec-4-enamide |
|---|---|
| PubChem CID | 162815356 |
| Molecular Formula | C25H40ClNO5 |
| Molecular Weight | 470.05 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | N-[3-chloro-2-(4-hydroxy-3-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl)prop-2-enyl]-7-methoxytetradec-4-enamide |
| SMILES | CCCCCCCC(CC=CCCC(=O)NCC(=CCl)C12OC1CC(O)C(C)C2=O)OC |
| InChI | InChI=1S/C25H40ClNO5/c1-4-5-6-7-9-12-20(31-3)13-10-8-11-14-23(29)27-17-19(16-26)25-22(32-25)15-21(28)18(2)24(25)30/h8,10,16,18,20-22,28H,4-7,9,11-15,17H2,1-3H3,(H,27,29) |
| InChIKey | YWLFVPLREWALDU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.05 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|