C31H55NO6 — CID 162845988
N-[2-hydroxy-2-(4-hydroxy-3,5,5-trimethyl-6-oxocyclohexen-1-yl)-3-methoxypropyl]-7-methoxy-9-methylhexadec-4-enamide (PubChem CID 162845988) has the molecular formula C31H55NO6 and a molecular weight of 537.78 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-hydroxy-3,5,5-trimethyl-6-oxocyclohexen-1-yl)-3-methoxypropyl]-7-methoxy-9-methylhexadec-4-enamide.
| Compound Name | N-[2-hydroxy-2-(4-hydroxy-3,5,5-trimethyl-6-oxocyclohexen-1-yl)-3-methoxypropyl]-7-methoxy-9-methylhexadec-4-enamide |
|---|---|
| PubChem CID | 162845988 |
| Molecular Formula | C31H55NO6 |
| Molecular Weight | 537.78 g/mol |
| Exact Mass | 537.40 |
| IUPAC Name | N-[2-hydroxy-2-(4-hydroxy-3,5,5-trimethyl-6-oxocyclohexen-1-yl)-3-methoxypropyl]-7-methoxy-9-methylhexadec-4-enamide |
| SMILES | CCCCCCCC(C)CC(CC=CCCC(=O)NCC(O)(COC)C1=CC(C)C(O)C(C)(C)C1=O)OC |
| InChI | InChI=1S/C31H55NO6/c1-8-9-10-11-13-16-23(2)19-25(38-7)17-14-12-15-18-27(33)32-21-31(36,22-37-6)26-20-24(3)28(34)30(4,5)29(26)35/h12,14,20,23-25,28,34,36H,8-11,13,15-19,21-22H2,1-7H3,(H,32,33) |
| InChIKey | SINXTMMIEHVQHI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|