C27H40O9 — CID 162917715
[(2R,3S,4S,5R,6S)-4,5-diacetyloxy-2-methyl-6-[(2S)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-oxohept-6-en-2-yl]oxyoxan-3-yl] acetate (PubChem CID 162917715) has the molecular formula C27H40O9 and a molecular weight of 508.61 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-4,5-diacetyloxy-2-methyl-6-[(2S)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-oxohept-6-en-2-yl]oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-4,5-diacetyloxy-2-methyl-6-[(2S)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-oxohept-6-en-2-yl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 162917715 |
| Molecular Formula | C27H40O9 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-4,5-diacetyloxy-2-methyl-6-[(2S)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-oxohept-6-en-2-yl]oxyoxan-3-yl] acetate |
| SMILES | C=C(C)C(=O)CC[C@](C)(O[C@@H]1O[C@H](C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)[C@@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C27H40O9/c1-15(2)22(31)13-14-27(8,21-11-9-16(3)10-12-21)36-26-25(35-20(7)30)24(34-19(6)29)23(17(4)32-26)33-18(5)28/h9,17,21,23-26H,1,10-14H2,2-8H3/t17-,21-,23+,24+,25-,26+,27+/m1/s1 |
| InChIKey | VZFHXCOIBHQWQJ-QRODIJQXSA-N |
| XLogP | 3.97 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|