C24H36O9 — CID 163030683
[(2R,3S,4S,5R,6S)-4,5-diacetyloxy-2-methyl-6-[(2S)-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-oxopentan-2-yl]oxyoxan-3-yl] acetate (PubChem CID 163030683) has the molecular formula C24H36O9 and a molecular weight of 468.54 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-4,5-diacetyloxy-2-methyl-6-[(2S)-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-oxopentan-2-yl]oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-4,5-diacetyloxy-2-methyl-6-[(2S)-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-oxopentan-2-yl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 163030683 |
| Molecular Formula | C24H36O9 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-4,5-diacetyloxy-2-methyl-6-[(2S)-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-oxopentan-2-yl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)[C@@H](C)O[C@@H](O[C@@](C)(CCC=O)[C@@H]2CC=C(C)CC2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H36O9/c1-14-8-10-19(11-9-14)24(6,12-7-13-25)33-23-22(32-18(5)28)21(31-17(4)27)20(15(2)29-23)30-16(3)26/h8,13,15,19-23H,7,9-12H2,1-6H3/t15-,19-,20+,21+,22-,23+,24+/m1/s1 |
| InChIKey | XOUUZSVTQKJJSX-IHIZVTIOSA-N |
| XLogP | 3.03 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|