C18H28N2O8 — CID 162949824
[2,3,4,5-tetrahydroxy-6-[3-methyl-2-(methylideneamino)but-2-enoyl]oxyhexyl] 3-methyl-2-(methylideneamino)but-2-enoate (PubChem CID 162949824) has the molecular formula C18H28N2O8 and a molecular weight of 400.43 g/mol. Its IUPAC name is [2,3,4,5-tetrahydroxy-6-[3-methyl-2-(methylideneamino)but-2-enoyl]oxyhexyl] 3-methyl-2-(methylideneamino)but-2-enoate.
| Compound Name | [2,3,4,5-tetrahydroxy-6-[3-methyl-2-(methylideneamino)but-2-enoyl]oxyhexyl] 3-methyl-2-(methylideneamino)but-2-enoate |
|---|---|
| PubChem CID | 162949824 |
| Molecular Formula | C18H28N2O8 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [2,3,4,5-tetrahydroxy-6-[3-methyl-2-(methylideneamino)but-2-enoyl]oxyhexyl] 3-methyl-2-(methylideneamino)but-2-enoate |
| SMILES | C=NC(C(=O)OCC(O)C(O)C(O)C(O)COC(=O)C(N=C)=C(C)C)=C(C)C |
| InChI | InChI=1S/C18H28N2O8/c1-9(2)13(19-5)17(25)27-7-11(21)15(23)16(24)12(22)8-28-18(26)14(20-6)10(3)4/h11-12,15-16,21-24H,5-8H2,1-4H3 |
| InChIKey | YNPCISSLHKFMKR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|