C31H42O9 — CID 162957432
[5,7-diacetyloxy-14,14-dimethyl-2-(3-methylpent-2-enoyloxy)-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-9-yl] 3-methylpent-2-enoate (PubChem CID 162957432) has the molecular formula C31H42O9 and a molecular weight of 558.67 g/mol. Its IUPAC name is [5,7-diacetyloxy-14,14-dimethyl-2-(3-methylpent-2-enoyloxy)-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-9-yl] 3-methylpent-2-enoate.
| Compound Name | [5,7-diacetyloxy-14,14-dimethyl-2-(3-methylpent-2-enoyloxy)-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-9-yl] 3-methylpent-2-enoate |
|---|---|
| PubChem CID | 162957432 |
| Molecular Formula | C31H42O9 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | [5,7-diacetyloxy-14,14-dimethyl-2-(3-methylpent-2-enoyloxy)-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-9-yl] 3-methylpent-2-enoate |
| SMILES | CCC(C)=CC(=O)OC1C=C2C(OC(C)=O)OC(OC(C)=O)C3C(OC(=O)C=C(C)CC)CC4C(C)(C)C1CC234 |
| InChI | InChI=1S/C31H42O9/c1-9-16(3)11-25(34)38-22-13-20-28(36-18(5)32)40-29(37-19(6)33)27-23(39-26(35)12-17(4)10-2)14-24-30(7,8)21(22)15-31(20,24)27/h11-13,21-24,27-29H,9-10,14-15H2,1-8H3 |
| InChIKey | OVMVACYNGQJGSF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|