C24H32O7 — CID 162845780
(5,7-diacetyloxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl) 3-methylbut-2-enoate (PubChem CID 162845780) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is (5,7-diacetyloxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl) 3-methylbut-2-enoate.
| Compound Name | (5,7-diacetyloxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl) 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 162845780 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (5,7-diacetyloxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl) 3-methylbut-2-enoate |
| SMILES | CC(=O)OC1OC(OC(C)=O)C2CCC3C(C)(C)C4CC23C1=CC4OC(=O)C=C(C)C |
| InChI | InChI=1S/C24H32O7/c1-12(2)9-20(27)30-18-10-16-22(29-14(4)26)31-21(28-13(3)25)15-7-8-19-23(5,6)17(18)11-24(15,16)19/h9-10,15,17-19,21-22H,7-8,11H2,1-6H3 |
| InChIKey | JQLIAXTXXMKSKB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|