C20H28O2 — CID 163020578
(4R,8S)-7,7-dimethyl-13-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),2,11,13-tetraene-4,14-diol (PubChem CID 163020578) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (4R,8S)-7,7-dimethyl-13-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),2,11,13-tetraene-4,14-diol.
| Compound Name | (4R,8S)-7,7-dimethyl-13-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),2,11,13-tetraene-4,14-diol |
|---|---|
| PubChem CID | 163020578 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (4R,8S)-7,7-dimethyl-13-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),2,11,13-tetraene-4,14-diol |
| SMILES | CC(C)c1cc2c(cc1O)C=C1[C@H](O)CCC(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C20H28O2/c1-12(2)15-9-13-5-6-17-16(10-14(13)11-19(15)22)18(21)7-8-20(17,3)4/h9-12,17-18,21-22H,5-8H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | KMWSMLWAQRRZOQ-QZTJIDSGSA-N |
| XLogP | 4.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |