C17H22O6 — CID 163065685
2,3,5-trihydroxy-7,10-dimethoxy-2-methyl-1,3,4,4a,9a,10-hexahydroanthracen-9-one (PubChem CID 163065685) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2,3,5-trihydroxy-7,10-dimethoxy-2-methyl-1,3,4,4a,9a,10-hexahydroanthracen-9-one.
| Compound Name | 2,3,5-trihydroxy-7,10-dimethoxy-2-methyl-1,3,4,4a,9a,10-hexahydroanthracen-9-one |
|---|---|
| PubChem CID | 163065685 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2,3,5-trihydroxy-7,10-dimethoxy-2-methyl-1,3,4,4a,9a,10-hexahydroanthracen-9-one |
| SMILES | COc1cc(O)c2c(c1)C(=O)C1CC(C)(O)C(O)CC1C2OC |
| InChI | InChI=1S/C17H22O6/c1-17(21)7-11-9(6-13(17)19)16(23-3)14-10(15(11)20)4-8(22-2)5-12(14)18/h4-5,9,11,13,16,18-19,21H,6-7H2,1-3H3 |
| InChIKey | HHHWMYHCKIUPAR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |