C20H34O3 — CID 163099177
4-[4-[(1E,3E,5S)-5-hydroxydeca-1,3-dienyl]cyclohexyl]butanoic acid (PubChem CID 163099177) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 4-[4-[(1E,3E,5S)-5-hydroxydeca-1,3-dienyl]cyclohexyl]butanoic acid.
| Compound Name | 4-[4-[(1E,3E,5S)-5-hydroxydeca-1,3-dienyl]cyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 163099177 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 4-[4-[(1E,3E,5S)-5-hydroxydeca-1,3-dienyl]cyclohexyl]butanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/C=C/C1CCC(CCCC(=O)O)CC1 |
| InChI | InChI=1S/C20H34O3/c1-2-3-4-10-19(21)11-6-5-8-17-13-15-18(16-14-17)9-7-12-20(22)23/h5-6,8,11,17-19,21H,2-4,7,9-10,12-16H2,1H3,(H,22,23)/b8-5+,11-6+/t17?,18?,19-/m0/s1 |
| InChIKey | FHVGNOGWCPWWCB-CAXTXHQYSA-N |
| XLogP | 5.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|