C16H20Br2O2 — CID 163109130
2-(5-bromohepta-2,4-dienyl)-5-(3-bromopropa-1,2-dienyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 163109130) has the molecular formula C16H20Br2O2 and a molecular weight of 404.14 g/mol. Its IUPAC name is 2-(5-bromohepta-2,4-dienyl)-5-(3-bromopropa-1,2-dienyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | 2-(5-bromohepta-2,4-dienyl)-5-(3-bromopropa-1,2-dienyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 163109130 |
| Molecular Formula | C16H20Br2O2 |
| Molecular Weight | 404.14 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 2-(5-bromohepta-2,4-dienyl)-5-(3-bromopropa-1,2-dienyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CCC(Br)=CC=CCC1CC2OC(C=C=CBr)CC2O1 |
| InChI | InChI=1S/C16H20Br2O2/c1-2-12(18)6-3-4-7-13-10-15-16(19-13)11-14(20-15)8-5-9-17/h3-4,6,8-9,13-16H,2,7,10-11H2,1H3 |
| InChIKey | GURBJGFKZHKTEZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.14 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|