C15H19Br3O3 — CID 91306684
(2R,3S,5R)-5-(3-bromopropa-1,2-dienyl)-2-[(1S,2R)-1,6-dibromo-2-hydroxyocta-3,5-dienyl]oxolan-3-ol (PubChem CID 91306684) has the molecular formula C15H19Br3O3 and a molecular weight of 487.03 g/mol. Its IUPAC name is (2R,3S,5R)-5-(3-bromopropa-1,2-dienyl)-2-[(1S,2R)-1,6-dibromo-2-hydroxyocta-3,5-dienyl]oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(3-bromopropa-1,2-dienyl)-2-[(1S,2R)-1,6-dibromo-2-hydroxyocta-3,5-dienyl]oxolan-3-ol |
|---|---|
| PubChem CID | 91306684 |
| Molecular Formula | C15H19Br3O3 |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 483.89 |
| IUPAC Name | (2R,3S,5R)-5-(3-bromopropa-1,2-dienyl)-2-[(1S,2R)-1,6-dibromo-2-hydroxyocta-3,5-dienyl]oxolan-3-ol |
| SMILES | CCC(Br)=CC=C[C@@H](O)[C@H](Br)[C@@H]1O[C@@H](C=C=CBr)C[C@@H]1O |
| InChI | InChI=1S/C15H19Br3O3/c1-2-10(17)5-3-7-12(19)14(18)15-13(20)9-11(21-15)6-4-8-16/h3,5-8,11-15,19-20H,2,9H2,1H3/t4?,11-,12+,13-,14-,15+/m0/s1 |
| InChIKey | UTNSPXWSOISNAK-DJSHXPIYSA-N |
| XLogP | 3.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|