C21H27ClN2O2 — CID 163142780
[(1S,2R,3R,4aS,9aR)-3-chloro-2-ethenyl-8-formamido-2,10,10-trimethyl-9-oxo-3,4,4a,9a-tetrahydro-1H-anthracen-1-yl]-methanidylazanium (PubChem CID 163142780) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is [(1S,2R,3R,4aS,9aR)-3-chloro-2-ethenyl-8-formamido-2,10,10-trimethyl-9-oxo-3,4,4a,9a-tetrahydro-1H-anthracen-1-yl]-methanidylazanium.
| Compound Name | [(1S,2R,3R,4aS,9aR)-3-chloro-2-ethenyl-8-formamido-2,10,10-trimethyl-9-oxo-3,4,4a,9a-tetrahydro-1H-anthracen-1-yl]-methanidylazanium |
|---|---|
| PubChem CID | 163142780 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | [(1S,2R,3R,4aS,9aR)-3-chloro-2-ethenyl-8-formamido-2,10,10-trimethyl-9-oxo-3,4,4a,9a-tetrahydro-1H-anthracen-1-yl]-methanidylazanium |
| SMILES | C=C[C@@]1(C)[C@H](Cl)C[C@H]2[C@@H](C(=O)c3c(NC=O)cccc3C2(C)C)[C@@H]1[NH2+][CH2-] |
| InChI | InChI=1S/C21H27ClN2O2/c1-6-21(4)15(22)10-13-17(19(21)23-5)18(26)16-12(20(13,2)3)8-7-9-14(16)24-11-25/h6-9,11,13,15,17,19H,1,5,10,23H2,2-4H3,(H,24,25)/t13-,15+,17-,19-,21-/m0/s1 |
| InChIKey | KKBLVLCTJFOCCL-WSPVJSELSA-N |
| XLogP | 2.89 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|