C30H42N6O7 — CID 163194735
N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]-1-[(2S)-2-[[(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]pyrrolidine-2-carboxamide (PubChem CID 163194735) has the molecular formula C30H42N6O7 and a molecular weight of 598.70 g/mol. Its IUPAC name is N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]-1-[(2S)-2-[[(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]-1-[(2S)-2-[[(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163194735 |
| Molecular Formula | C30H42N6O7 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]-1-[(2S)-2-[[(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NCCCC(CO)NC(=O)C1CCCN1C(=O)[C@H](CCc1ccc(O)cc1)NC(=O)[C@H](O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C30H42N6O7/c31-30(32)33-15-1-3-21(18-37)34-27(41)25-4-2-16-36(25)29(43)24(14-9-19-5-10-22(38)11-6-19)35-28(42)26(40)17-20-7-12-23(39)13-8-20/h5-8,10-13,21,24-26,37-40H,1-4,9,14-18H2,(H,34,41)(H,35,42)(H4,31,32,33)/t21?,24-,25?,26+/m0/s1 |
| InChIKey | KRNLOYZRJLTDBI-HGHORJGHSA-N |
| XLogP | -0.36 |
| TPSA | 223.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|