C31H45N4O3S+ — CID 163196079
4-[[3,3-dimethyl-2-[(2,4,4,9-tetramethyl-3H-pyrido[3,4-b]indol-2-ium-3-carbonyl)amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enethioic S-acid (PubChem CID 163196079) has the molecular formula C31H45N4O3S+ and a molecular weight of 553.79 g/mol. Its IUPAC name is 4-[[3,3-dimethyl-2-[(2,4,4,9-tetramethyl-3H-pyrido[3,4-b]indol-2-ium-3-carbonyl)amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enethioic S-acid.
| Compound Name | 4-[[3,3-dimethyl-2-[(2,4,4,9-tetramethyl-3H-pyrido[3,4-b]indol-2-ium-3-carbonyl)amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enethioic S-acid |
|---|---|
| PubChem CID | 163196079 |
| Molecular Formula | C31H45N4O3S+ |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 4-[[3,3-dimethyl-2-[(2,4,4,9-tetramethyl-3H-pyrido[3,4-b]indol-2-ium-3-carbonyl)amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enethioic S-acid |
| SMILES | CC(=CC(C(C)C)N(C)C(=O)C(NC(=O)C1[N+](C)=Cc2c(c3ccccc3n2C)C1(C)C)C(C)(C)C)C(=O)S |
| InChI | InChI=1S/C31H44N4O3S/c1-18(2)22(16-19(3)29(38)39)35(11)28(37)25(30(4,5)6)32-27(36)26-31(7,8)24-20-14-12-13-15-21(20)34(10)23(24)17-33(26)9/h12-18,22,25-26H,1-11H3,(H-,32,36,38,39)/p+1 |
| InChIKey | AUAGTVLGYPCJSG-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|