C20H32N5O11P — CID 163197521
[(3-carboxyoxy-2,4-dimethylpentan-3-yl)oxy-[2-[6-(methoxymethylamino)purin-9-yl]ethoxymethyl]phosphoryl]oxymethyl hydrogen carbonate (PubChem CID 163197521) has the molecular formula C20H32N5O11P and a molecular weight of 549.47 g/mol. Its IUPAC name is [(3-carboxyoxy-2,4-dimethylpentan-3-yl)oxy-[2-[6-(methoxymethylamino)purin-9-yl]ethoxymethyl]phosphoryl]oxymethyl hydrogen carbonate.
| Compound Name | [(3-carboxyoxy-2,4-dimethylpentan-3-yl)oxy-[2-[6-(methoxymethylamino)purin-9-yl]ethoxymethyl]phosphoryl]oxymethyl hydrogen carbonate |
|---|---|
| PubChem CID | 163197521 |
| Molecular Formula | C20H32N5O11P |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | [(3-carboxyoxy-2,4-dimethylpentan-3-yl)oxy-[2-[6-(methoxymethylamino)purin-9-yl]ethoxymethyl]phosphoryl]oxymethyl hydrogen carbonate |
| SMILES | COCNc1ncnc2c1ncn2CCOCP(=O)(OCOC(=O)O)OC(OC(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H32N5O11P/c1-13(2)20(14(3)4,35-19(28)29)36-37(30,34-11-33-18(26)27)12-32-7-6-25-9-23-15-16(24-10-31-5)21-8-22-17(15)25/h8-9,13-14H,6-7,10-12H2,1-5H3,(H,26,27)(H,28,29)(H,21,22,24) |
| InChIKey | QBHCHPAQRNVOOZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 202.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|