C15H24N5O6P — CID 141190274
methyl-[2-[6-(3-methylbutoxycarbamoyl)purin-9-yl]ethoxymethoxy]phosphinic acid (PubChem CID 141190274) has the molecular formula C15H24N5O6P and a molecular weight of 401.36 g/mol. Its IUPAC name is methyl-[2-[6-(3-methylbutoxycarbamoyl)purin-9-yl]ethoxymethoxy]phosphinic acid.
| Compound Name | methyl-[2-[6-(3-methylbutoxycarbamoyl)purin-9-yl]ethoxymethoxy]phosphinic acid |
|---|---|
| PubChem CID | 141190274 |
| Molecular Formula | C15H24N5O6P |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | methyl-[2-[6-(3-methylbutoxycarbamoyl)purin-9-yl]ethoxymethoxy]phosphinic acid |
| SMILES | CC(C)CCONC(=O)c1ncnc2c1ncn2CCOCOP(C)(=O)O |
| InChI | InChI=1S/C15H24N5O6P/c1-11(2)4-6-25-19-15(21)13-12-14(17-8-16-13)20(9-18-12)5-7-24-10-26-27(3,22)23/h8-9,11H,4-7,10H2,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | FGSFNSSAVBYOKA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|