C15H21F3N5O6P — CID 25157574
2-[6-(2-methylpropoxycarbonylamino)purin-9-yl]ethoxymethyl-(2,2,2-trifluoroethoxy)phosphinic acid (PubChem CID 25157574) has the molecular formula C15H21F3N5O6P and a molecular weight of 455.33 g/mol. Its IUPAC name is 2-[6-(2-methylpropoxycarbonylamino)purin-9-yl]ethoxymethyl-(2,2,2-trifluoroethoxy)phosphinic acid.
| Compound Name | 2-[6-(2-methylpropoxycarbonylamino)purin-9-yl]ethoxymethyl-(2,2,2-trifluoroethoxy)phosphinic acid |
|---|---|
| PubChem CID | 25157574 |
| Molecular Formula | C15H21F3N5O6P |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-[6-(2-methylpropoxycarbonylamino)purin-9-yl]ethoxymethyl-(2,2,2-trifluoroethoxy)phosphinic acid |
| SMILES | CC(C)COC(=O)Nc1ncnc2c1ncn2CCOCP(=O)(O)OCC(F)(F)F |
| InChI | InChI=1S/C15H21F3N5O6P/c1-10(2)5-28-14(24)22-12-11-13(20-7-19-12)23(8-21-11)3-4-27-9-30(25,26)29-6-15(16,17)18/h7-8,10H,3-6,9H2,1-2H3,(H,25,26)(H,19,20,22,24) |
| InChIKey | XTRVFQNWPQUSQZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|