C27H45N6O5P — CID 59058228
2-[6-[[(9Z,12Z)-octadeca-9,12-dienyl]carbamoylamino]purin-9-yl]ethoxymethylphosphonic acid (PubChem CID 59058228) has the molecular formula C27H45N6O5P and a molecular weight of 564.67 g/mol. Its IUPAC name is 2-[6-[[(9Z,12Z)-octadeca-9,12-dienyl]carbamoylamino]purin-9-yl]ethoxymethylphosphonic acid.
| Compound Name | 2-[6-[[(9Z,12Z)-octadeca-9,12-dienyl]carbamoylamino]purin-9-yl]ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 59058228 |
| Molecular Formula | C27H45N6O5P |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | 2-[6-[[(9Z,12Z)-octadeca-9,12-dienyl]carbamoylamino]purin-9-yl]ethoxymethylphosphonic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCNC(=O)Nc1ncnc2c1ncn2CCOCP(=O)(O)O |
| InChI | InChI=1S/C27H45N6O5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-28-27(34)32-25-24-26(30-21-29-25)33(22-31-24)19-20-38-23-39(35,36)37/h6-7,9-10,21-22H,2-5,8,11-20,23H2,1H3,(H2,35,36,37)(H2,28,29,30,32,34)/b7-6-,10-9- |
| InChIKey | QNRVKVBMLXXYNV-HZJYTTRNSA-N |
| XLogP | 5.91 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|