C19H30N5O9P — CID 97305124
[[(R)-2-[6-(2,2-dimethylpropanoylamino)purin-9-yl]ethoxy-hydroxymethoxy]-hydroxyphosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 97305124) has the molecular formula C19H30N5O9P and a molecular weight of 503.45 g/mol. Its IUPAC name is [[(R)-2-[6-(2,2-dimethylpropanoylamino)purin-9-yl]ethoxy-hydroxymethoxy]-hydroxyphosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[(R)-2-[6-(2,2-dimethylpropanoylamino)purin-9-yl]ethoxy-hydroxymethoxy]-hydroxyphosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 97305124 |
| Molecular Formula | C19H30N5O9P |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | [[(R)-2-[6-(2,2-dimethylpropanoylamino)purin-9-yl]ethoxy-hydroxymethoxy]-hydroxyphosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Nc1ncnc2c1ncn2CCO[C@@H](O)OP(=O)(O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H30N5O9P/c1-18(2,3)15(25)23-13-12-14(21-9-20-13)24(10-22-12)7-8-30-17(27)33-34(28,29)32-11-31-16(26)19(4,5)6/h9-10,17,27H,7-8,11H2,1-6H3,(H,28,29)(H,20,21,23,25)/t17-/m1/s1 |
| InChIKey | BMVFFNMPLJLFMU-QGZVFWFLSA-N |
| XLogP | 1.78 |
| TPSA | 184.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|