C24H23NO3S2 — CID 163201565
4-methyl-N-[oxo-(2-phenylethynyl)-(2,4,6-trimethylphenyl)-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 163201565) has the molecular formula C24H23NO3S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 4-methyl-N-[oxo-(2-phenylethynyl)-(2,4,6-trimethylphenyl)-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[oxo-(2-phenylethynyl)-(2,4,6-trimethylphenyl)-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 163201565 |
| Molecular Formula | C24H23NO3S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 4-methyl-N-[oxo-(2-phenylethynyl)-(2,4,6-trimethylphenyl)-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(C#Cc2ccccc2)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C24H23NO3S2/c1-18-10-12-23(13-11-18)30(27,28)25-29(26,15-14-22-8-6-5-7-9-22)24-20(3)16-19(2)17-21(24)4/h5-13,16-17H,1-4H3 |
| InChIKey | IZFMJTJCUKXBEL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|